About CID 73091113
CID 73091113 (PubChem CID 73091113) has the molecular formula C29H33F6P2
and a molecular weight of 557.52 g/mol.
Molecular Properties
| Compound Name | CID 73091113 |
| PubChem CID | 73091113 |
| Molecular Formula | C29H33F6P2 |
| Molecular Weight | 557.52 g/mol |
| Exact Mass | 557.20 |
| IUPAC Name | — |
| SMILES | CC([C]1[CH][CH][CH][C]1P(c1ccc(C(F)(F)F)cc1)c1ccc(C(F)(F)F)cc1)P(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C29H33F6P2/c1-19(37(26(2,3)4)27(5,6)7)24-9-8-10-25(24)36(22-15-11-20(12-16-22)28(30,31)32)23-17-13-21(14-18-23)29(33,34)35/h8-19H,1-7H3 |
| InChIKey | UDHCWLXATOQMHB-UHFFFAOYSA-N |
| XLogP | 9.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 557.52 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 73091113 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 73091113?
The IUPAC name of CID 73091113 (CID 73091113) is not available.
What is the SMILES notation for CID 73091113?
The canonical SMILES for CID 73091113 is CC([C]1[CH][CH][CH][C]1P(c1ccc(C(F)(F)F)cc1)c1ccc(C(F)(F)F)cc1)P(C(C)(C)C)C(C)(C)C.
What is the InChIKey of CID 73091113?
The InChIKey is UDHCWLXATOQMHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H33F6P2/c1-19(37(26(2,3)4)27(5,6)7)24-9-8-10-25(24)36(22-15-11-20(12-16-22)28(30,31)32)23-17-13-21(14-18-23)29(33,34)35/h8-19H,1-7H3.
What are the key properties of CID 73091113?
CID 73091113 has a molecular weight of 557.52 g/mol, XLogP of 9.36, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 73091113 is sourced from PubChem (CID 73091113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).