C29H38F6P2 — CID 140562071
[(1S)-2-[1-bis[4-(trifluoromethyl)phenyl]phosphanylethyl]cyclopentyl]-ditert-butylphosphane (PubChem CID 140562071) has the molecular formula C29H38F6P2 and a molecular weight of 562.56 g/mol. Its IUPAC name is [(1S)-2-[1-bis[4-(trifluoromethyl)phenyl]phosphanylethyl]cyclopentyl]-ditert-butylphosphane.
| Compound Name | [(1S)-2-[1-bis[4-(trifluoromethyl)phenyl]phosphanylethyl]cyclopentyl]-ditert-butylphosphane |
|---|---|
| PubChem CID | 140562071 |
| Molecular Formula | C29H38F6P2 |
| Molecular Weight | 562.56 g/mol |
| Exact Mass | 562.24 |
| IUPAC Name | [(1S)-2-[1-bis[4-(trifluoromethyl)phenyl]phosphanylethyl]cyclopentyl]-ditert-butylphosphane |
| SMILES | CC(C1CCC[C@@H]1P(C(C)(C)C)C(C)(C)C)P(c1ccc(C(F)(F)F)cc1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C29H38F6P2/c1-19(24-9-8-10-25(24)37(26(2,3)4)27(5,6)7)36(22-15-11-20(12-16-22)28(30,31)32)23-17-13-21(14-18-23)29(33,34)35/h11-19,24-25H,8-10H2,1-7H3/t19?,24?,25-/m0/s1 |
| InChIKey | JHOPRSRWKGYDIM-GATLKJJBSA-N |
| XLogP | 9.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.56 |
| LogP ≤ 5 | 9.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|