C23H32OP2 — CID 155884992
[(1S)-1-(2-tert-butylphosphonoylcyclopentyl)ethyl]-diphenylphosphane (PubChem CID 155884992) has the molecular formula C23H32OP2 and a molecular weight of 386.46 g/mol. Its IUPAC name is [(1S)-1-(2-tert-butylphosphonoylcyclopentyl)ethyl]-diphenylphosphane.
| Compound Name | [(1S)-1-(2-tert-butylphosphonoylcyclopentyl)ethyl]-diphenylphosphane |
|---|---|
| PubChem CID | 155884992 |
| Molecular Formula | C23H32OP2 |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | [(1S)-1-(2-tert-butylphosphonoylcyclopentyl)ethyl]-diphenylphosphane |
| SMILES | C[C@@H](C1CCCC1[P@@H](=O)C(C)(C)C)P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H32OP2/c1-18(21-16-11-17-22(21)26(24)23(2,3)4)25(19-12-7-5-8-13-19)20-14-9-6-10-15-20/h5-10,12-15,18,21-22,26H,11,16-17H2,1-4H3/t18-,21?,22?/m0/s1 |
| InChIKey | HDNCVJGCYJZXTF-XTWGIRIWSA-N |
| XLogP | 6.03 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|