C26H46FeOP2 — CID 155884987
cyclopentane;ditert-butyl-[(1R)-1-(2-phenylphosphonoylcyclopentyl)ethyl]phosphane;iron (PubChem CID 155884987) has the molecular formula C26H46FeOP2 and a molecular weight of 492.45 g/mol. Its IUPAC name is cyclopentane;ditert-butyl-[(1R)-1-(2-phenylphosphonoylcyclopentyl)ethyl]phosphane;iron.
| Compound Name | cyclopentane;ditert-butyl-[(1R)-1-(2-phenylphosphonoylcyclopentyl)ethyl]phosphane;iron |
|---|---|
| PubChem CID | 155884987 |
| Molecular Formula | C26H46FeOP2 |
| Molecular Weight | 492.45 g/mol |
| Exact Mass | 492.24 |
| IUPAC Name | cyclopentane;ditert-butyl-[(1R)-1-(2-phenylphosphonoylcyclopentyl)ethyl]phosphane;iron |
| SMILES | C1CCCC1.C[C@H](C1CCCC1[P@H](=O)c1ccccc1)P(C(C)(C)C)C(C)(C)C.[Fe] |
| InChI | InChI=1S/C21H36OP2.C5H10.Fe/c1-16(24(20(2,3)4)21(5,6)7)18-14-11-15-19(18)23(22)17-12-9-8-10-13-17;1-2-4-5-3-1;/h8-10,12-13,16,18-19,23H,11,14-15H2,1-7H3;1-5H2;/t16-,18?,19?;;/m1../s1 |
| InChIKey | HSJCEAMBOJRPRD-CNSRXUDHSA-N |
| XLogP | 8.46 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.45 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|