C34H54FeP2 — CID 162287013
1-[2-bis(4-methylphenyl)phosphanylcyclopentyl]ethyl-ditert-butylphosphane;cyclopentane;iron (PubChem CID 162287013) has the molecular formula C34H54FeP2 and a molecular weight of 580.60 g/mol. Its IUPAC name is 1-[2-bis(4-methylphenyl)phosphanylcyclopentyl]ethyl-ditert-butylphosphane;cyclopentane;iron.
| Compound Name | 1-[2-bis(4-methylphenyl)phosphanylcyclopentyl]ethyl-ditert-butylphosphane;cyclopentane;iron |
|---|---|
| PubChem CID | 162287013 |
| Molecular Formula | C34H54FeP2 |
| Molecular Weight | 580.60 g/mol |
| Exact Mass | 580.31 |
| IUPAC Name | 1-[2-bis(4-methylphenyl)phosphanylcyclopentyl]ethyl-ditert-butylphosphane;cyclopentane;iron |
| SMILES | C1CCCC1.Cc1ccc(P(c2ccc(C)cc2)C2CCCC2C(C)P(C(C)(C)C)C(C)(C)C)cc1.[Fe] |
| InChI | InChI=1S/C29H44P2.C5H10.Fe/c1-21-13-17-24(18-14-21)30(25-19-15-22(2)16-20-25)27-12-10-11-26(27)23(3)31(28(4,5)6)29(7,8)9;1-2-4-5-3-1;/h13-20,23,26-27H,10-12H2,1-9H3;1-5H2; |
| InChIKey | PAMCCODGFDJRFG-UHFFFAOYSA-N |
| XLogP | 10.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.60 |
| LogP ≤ 5 | 10.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|