C31H32P2 — CID 141093024
[(1S)-1-[(1R,2R)-2-diphenylphosphanylcyclopentyl]ethyl]-diphenylphosphane (PubChem CID 141093024) has the molecular formula C31H32P2 and a molecular weight of 466.55 g/mol. Its IUPAC name is [(1S)-1-[(1R,2R)-2-diphenylphosphanylcyclopentyl]ethyl]-diphenylphosphane.
| Compound Name | [(1S)-1-[(1R,2R)-2-diphenylphosphanylcyclopentyl]ethyl]-diphenylphosphane |
|---|---|
| PubChem CID | 141093024 |
| Molecular Formula | C31H32P2 |
| Molecular Weight | 466.55 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | [(1S)-1-[(1R,2R)-2-diphenylphosphanylcyclopentyl]ethyl]-diphenylphosphane |
| SMILES | C[C@@H]([C@H]1CCC[C@H]1P(c1ccccc1)c1ccccc1)P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H32P2/c1-25(32(26-15-6-2-7-16-26)27-17-8-3-9-18-27)30-23-14-24-31(30)33(28-19-10-4-11-20-28)29-21-12-5-13-22-29/h2-13,15-22,25,30-31H,14,23-24H2,1H3/t25-,30+,31+/m0/s1 |
| InChIKey | YKWKRSUMPSPUSZ-WXKJZWBCSA-N |
| XLogP | 6.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.55 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|