C31H44P2 — CID 129406680
dicyclohexyl-[(1S)-1-[(1S,2R)-2-diphenylphosphanylcyclopentyl]ethyl]phosphane (PubChem CID 129406680) has the molecular formula C31H44P2 and a molecular weight of 478.64 g/mol. Its IUPAC name is dicyclohexyl-[(1S)-1-[(1S,2R)-2-diphenylphosphanylcyclopentyl]ethyl]phosphane.
| Compound Name | dicyclohexyl-[(1S)-1-[(1S,2R)-2-diphenylphosphanylcyclopentyl]ethyl]phosphane |
|---|---|
| PubChem CID | 129406680 |
| Molecular Formula | C31H44P2 |
| Molecular Weight | 478.64 g/mol |
| Exact Mass | 478.29 |
| IUPAC Name | dicyclohexyl-[(1S)-1-[(1S,2R)-2-diphenylphosphanylcyclopentyl]ethyl]phosphane |
| SMILES | C[C@@H]([C@@H]1CCC[C@H]1P(c1ccccc1)c1ccccc1)P(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C31H44P2/c1-25(32(26-15-6-2-7-16-26)27-17-8-3-9-18-27)30-23-14-24-31(30)33(28-19-10-4-11-20-28)29-21-12-5-13-22-29/h4-5,10-13,19-22,25-27,30-31H,2-3,6-9,14-18,23-24H2,1H3/t25-,30-,31+/m0/s1 |
| InChIKey | IHERDRRKNNMAEF-LGXAAPQCSA-N |
| XLogP | 8.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.64 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|