C29H44P2 — CID 76689541
1-[2-bis(4-methylphenyl)phosphanylcyclopentyl]ethyl-ditert-butylphosphane (PubChem CID 76689541) has the molecular formula C29H44P2 and a molecular weight of 454.62 g/mol. Its IUPAC name is 1-[2-bis(4-methylphenyl)phosphanylcyclopentyl]ethyl-ditert-butylphosphane.
| Compound Name | 1-[2-bis(4-methylphenyl)phosphanylcyclopentyl]ethyl-ditert-butylphosphane |
|---|---|
| PubChem CID | 76689541 |
| Molecular Formula | C29H44P2 |
| Molecular Weight | 454.62 g/mol |
| Exact Mass | 454.29 |
| IUPAC Name | 1-[2-bis(4-methylphenyl)phosphanylcyclopentyl]ethyl-ditert-butylphosphane |
| SMILES | Cc1ccc(P(c2ccc(C)cc2)C2CCCC2C(C)P(C(C)(C)C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C29H44P2/c1-21-13-17-24(18-14-21)30(25-19-15-22(2)16-20-25)27-12-10-11-26(27)23(3)31(28(4,5)6)29(7,8)9/h13-20,23,26-27H,10-12H2,1-9H3 |
| InChIKey | SNQAFBVWFFKHDQ-UHFFFAOYSA-N |
| XLogP | 8.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.62 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|