C38H62FeO2P2 — CID 162302601
[(1R)-1-[2-bis(2-propan-2-yloxyphenyl)phosphanylcyclopentyl]ethyl]-ditert-butylphosphane;cyclopentane;iron (PubChem CID 162302601) has the molecular formula C38H62FeO2P2 and a molecular weight of 668.70 g/mol. Its IUPAC name is [(1R)-1-[2-bis(2-propan-2-yloxyphenyl)phosphanylcyclopentyl]ethyl]-ditert-butylphosphane;cyclopentane;iron.
| Compound Name | [(1R)-1-[2-bis(2-propan-2-yloxyphenyl)phosphanylcyclopentyl]ethyl]-ditert-butylphosphane;cyclopentane;iron |
|---|---|
| PubChem CID | 162302601 |
| Molecular Formula | C38H62FeO2P2 |
| Molecular Weight | 668.70 g/mol |
| Exact Mass | 668.36 |
| IUPAC Name | [(1R)-1-[2-bis(2-propan-2-yloxyphenyl)phosphanylcyclopentyl]ethyl]-ditert-butylphosphane;cyclopentane;iron |
| SMILES | C1CCCC1.CC(C)Oc1ccccc1P(c1ccccc1OC(C)C)C1CCCC1[C@@H](C)P(C(C)(C)C)C(C)(C)C.[Fe] |
| InChI | InChI=1S/C33H52O2P2.C5H10.Fe/c1-23(2)34-27-18-12-14-20-30(27)36(31-21-15-13-19-28(31)35-24(3)4)29-22-16-17-26(29)25(5)37(32(6,7)8)33(9,10)11;1-2-4-5-3-1;/h12-15,18-21,23-26,29H,16-17,22H2,1-11H3;1-5H2;/t25-,26?,29?;;/m1../s1 |
| InChIKey | SIORPEICEFCHOP-PSQGFWASSA-N |
| XLogP | 11.28 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.70 |
| LogP ≤ 5 | 11.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|