C33H52O2P2 — CID 123791753
1-[2-bis(2-propan-2-yloxyphenyl)phosphanylcyclopentyl]ethyl-ditert-butylphosphane (PubChem CID 123791753) has the molecular formula C33H52O2P2 and a molecular weight of 542.73 g/mol. Its IUPAC name is 1-[2-bis(2-propan-2-yloxyphenyl)phosphanylcyclopentyl]ethyl-ditert-butylphosphane.
| Compound Name | 1-[2-bis(2-propan-2-yloxyphenyl)phosphanylcyclopentyl]ethyl-ditert-butylphosphane |
|---|---|
| PubChem CID | 123791753 |
| Molecular Formula | C33H52O2P2 |
| Molecular Weight | 542.73 g/mol |
| Exact Mass | 542.34 |
| IUPAC Name | 1-[2-bis(2-propan-2-yloxyphenyl)phosphanylcyclopentyl]ethyl-ditert-butylphosphane |
| SMILES | CC(C)Oc1ccccc1P(c1ccccc1OC(C)C)C1CCCC1C(C)P(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C33H52O2P2/c1-23(2)34-27-18-12-14-20-30(27)36(31-21-15-13-19-28(31)35-24(3)4)29-22-16-17-26(29)25(5)37(32(6,7)8)33(9,10)11/h12-15,18-21,23-26,29H,16-17,22H2,1-11H3 |
| InChIKey | AMKBDILNZRHMGI-UHFFFAOYSA-N |
| XLogP | 9.33 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.73 |
| LogP ≤ 5 | 9.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|