C19H41OP2+ — CID 58470957
tert-butyl-[2-[(1S)-1-ditert-butylphosphanylethyl]cyclopentyl]-hydroxyphosphanium (PubChem CID 58470957) has the molecular formula C19H41OP2+ and a molecular weight of 347.48 g/mol. Its IUPAC name is tert-butyl-[2-[(1S)-1-ditert-butylphosphanylethyl]cyclopentyl]-hydroxyphosphanium.
| Compound Name | tert-butyl-[2-[(1S)-1-ditert-butylphosphanylethyl]cyclopentyl]-hydroxyphosphanium |
|---|---|
| PubChem CID | 58470957 |
| Molecular Formula | C19H41OP2+ |
| Molecular Weight | 347.48 g/mol |
| Exact Mass | 347.26 |
| IUPAC Name | tert-butyl-[2-[(1S)-1-ditert-butylphosphanylethyl]cyclopentyl]-hydroxyphosphanium |
| SMILES | C[C@@H](C1CCCC1[PH+](O)C(C)(C)C)P(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C19H40OP2/c1-14(21(17(2,3)4)18(5,6)7)15-12-11-13-16(15)22(20)19(8,9)10/h14-16,20H,11-13H2,1-10H3/p+1/t14-,15?,16?,22?/m0/s1 |
| InChIKey | XAKNXFIWNQEWFC-QRBXSHHESA-O |
| XLogP | 6.54 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.48 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|