C46H42F12FeP2 — CID 155886280
bis[3,5-bis(trifluoromethyl)phenyl]-[1-[2-(2-diphenylphosphanylphenyl)cyclopentyl]ethyl]phosphane;cyclopentane;iron (PubChem CID 155886280) has the molecular formula C46H42F12FeP2 and a molecular weight of 940.61 g/mol. Its IUPAC name is bis[3,5-bis(trifluoromethyl)phenyl]-[1-[2-(2-diphenylphosphanylphenyl)cyclopentyl]ethyl]phosphane;cyclopentane;iron.
| Compound Name | bis[3,5-bis(trifluoromethyl)phenyl]-[1-[2-(2-diphenylphosphanylphenyl)cyclopentyl]ethyl]phosphane;cyclopentane;iron |
|---|---|
| PubChem CID | 155886280 |
| Molecular Formula | C46H42F12FeP2 |
| Molecular Weight | 940.61 g/mol |
| Exact Mass | 940.19 |
| IUPAC Name | bis[3,5-bis(trifluoromethyl)phenyl]-[1-[2-(2-diphenylphosphanylphenyl)cyclopentyl]ethyl]phosphane;cyclopentane;iron |
| SMILES | C1CCCC1.CC(C1CCCC1c1ccccc1P(c1ccccc1)c1ccccc1)P(c1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1.[Fe] |
| InChI | InChI=1S/C41H32F12P2.C5H10.Fe/c1-25(34-16-10-17-35(34)36-15-8-9-18-37(36)55(30-11-4-2-5-12-30)31-13-6-3-7-14-31)54(32-21-26(38(42,43)44)19-27(22-32)39(45,46)47)33-23-28(40(48,49)50)20-29(24-33)41(51,52)53;1-2-4-5-3-1;/h2-9,11-15,18-25,34-35H,10,16-17H2,1H3;1-5H2; |
| InChIKey | UGNFNGUNDBJCHZ-UHFFFAOYSA-N |
| XLogP | 13.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 940.61 |
| LogP ≤ 5 | 13.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|