C46H63F3FeP2 — CID 162302609
cyclopentane;dicyclohexyl-[2-[2-[(1R)-1-[(3,5-dimethylphenyl)-[3-methyl-5-(trifluoromethyl)phenyl]phosphanyl]ethyl]cyclopentyl]phenyl]phosphane;iron (PubChem CID 162302609) has the molecular formula C46H63F3FeP2 and a molecular weight of 790.80 g/mol. Its IUPAC name is cyclopentane;dicyclohexyl-[2-[2-[(1R)-1-[(3,5-dimethylphenyl)-[3-methyl-5-(trifluoromethyl)phenyl]phosphanyl]ethyl]cyclopentyl]phenyl]phosphane;iron.
| Compound Name | cyclopentane;dicyclohexyl-[2-[2-[(1R)-1-[(3,5-dimethylphenyl)-[3-methyl-5-(trifluoromethyl)phenyl]phosphanyl]ethyl]cyclopentyl]phenyl]phosphane;iron |
|---|---|
| PubChem CID | 162302609 |
| Molecular Formula | C46H63F3FeP2 |
| Molecular Weight | 790.80 g/mol |
| Exact Mass | 790.37 |
| IUPAC Name | cyclopentane;dicyclohexyl-[2-[2-[(1R)-1-[(3,5-dimethylphenyl)-[3-methyl-5-(trifluoromethyl)phenyl]phosphanyl]ethyl]cyclopentyl]phenyl]phosphane;iron |
| SMILES | C1CCCC1.Cc1cc(C)cc(P(c2cc(C)cc(C(F)(F)F)c2)[C@H](C)C2CCCC2c2ccccc2P(C2CCCCC2)C2CCCCC2)c1.[Fe] |
| InChI | InChI=1S/C41H53F3P2.C5H10.Fe/c1-28-22-29(2)25-35(24-28)45(36-26-30(3)23-32(27-36)41(42,43)44)31(4)37-19-13-20-38(37)39-18-11-12-21-40(39)46(33-14-7-5-8-15-33)34-16-9-6-10-17-34;1-2-4-5-3-1;/h11-12,18,21-27,31,33-34,37-38H,5-10,13-17,19-20H2,1-4H3;1-5H2;/t31-,37?,38?,45?;;/m1../s1 |
| InChIKey | XDJKWXJXURKBIR-XBZFEGFBSA-N |
| XLogP | 13.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.80 |
| LogP ≤ 5 | 13.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|