C46H31F24NO2P2 — CID 166984282
(S)-bis[3,5-bis(trifluoromethyl)phenyl]phosphanyl-[2-[2-bis[4-methoxy-3,5-bis(trifluoromethyl)phenyl]phosphanylphenyl]cyclopentyl]methanamine (PubChem CID 166984282) has the molecular formula C46H31F24NO2P2 and a molecular weight of 1147.66 g/mol. Its IUPAC name is (S)-bis[3,5-bis(trifluoromethyl)phenyl]phosphanyl-[2-[2-bis[4-methoxy-3,5-bis(trifluoromethyl)phenyl]phosphanylphenyl]cyclopentyl]methanamine.
| Compound Name | (S)-bis[3,5-bis(trifluoromethyl)phenyl]phosphanyl-[2-[2-bis[4-methoxy-3,5-bis(trifluoromethyl)phenyl]phosphanylphenyl]cyclopentyl]methanamine |
|---|---|
| PubChem CID | 166984282 |
| Molecular Formula | C46H31F24NO2P2 |
| Molecular Weight | 1147.66 g/mol |
| Exact Mass | 1147.14 |
| IUPAC Name | (S)-bis[3,5-bis(trifluoromethyl)phenyl]phosphanyl-[2-[2-bis[4-methoxy-3,5-bis(trifluoromethyl)phenyl]phosphanylphenyl]cyclopentyl]methanamine |
| SMILES | COc1c(C(F)(F)F)cc(P(c2cc(C(F)(F)F)c(OC)c(C(F)(F)F)c2)c2ccccc2C2CCCC2[C@@H](N)P(c2cc(C(F)(F)F)cc(C(F)(F)F)c2)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1C(F)(F)F |
| InChI | InChI=1S/C46H31F24NO2P2/c1-72-36-31(43(59,60)61)16-26(17-32(36)44(62,63)64)74(27-18-33(45(65,66)67)37(73-2)34(19-27)46(68,69)70)35-9-4-3-6-29(35)28-7-5-8-30(28)38(71)75(24-12-20(39(47,48)49)10-21(13-24)40(50,51)52)25-14-22(41(53,54)55)11-23(15-25)42(56,57)58/h3-4,6,9-19,28,30,38H,5,7-8,71H2,1-2H3/t28?,30?,38-/m0/s1 |
| InChIKey | XYZHMECUHVIPNY-NMWZIIKHSA-N |
| XLogP | 14.91 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 75 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1147.66 |
| LogP ≤ 5 | 14.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|