C39H48P2 — CID 98462259
[(1S,2R,4R)-2-bicyclo[2.2.1]heptanyl]-[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]-[(1R)-1-[2-(2-diphenylphosphanylphenyl)cyclopentyl]ethyl]phosphane (PubChem CID 98462259) has the molecular formula C39H48P2 and a molecular weight of 578.76 g/mol. Its IUPAC name is [(1S,2R,4R)-2-bicyclo[2.2.1]heptanyl]-[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]-[(1R)-1-[2-(2-diphenylphosphanylphenyl)cyclopentyl]ethyl]phosphane.
| Compound Name | [(1S,2R,4R)-2-bicyclo[2.2.1]heptanyl]-[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]-[(1R)-1-[2-(2-diphenylphosphanylphenyl)cyclopentyl]ethyl]phosphane |
|---|---|
| PubChem CID | 98462259 |
| Molecular Formula | C39H48P2 |
| Molecular Weight | 578.76 g/mol |
| Exact Mass | 578.32 |
| IUPAC Name | [(1S,2R,4R)-2-bicyclo[2.2.1]heptanyl]-[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]-[(1R)-1-[2-(2-diphenylphosphanylphenyl)cyclopentyl]ethyl]phosphane |
| SMILES | C[C@H](C1CCCC1c1ccccc1P(c1ccccc1)c1ccccc1)P([C@@H]1C[C@@H]2CC[C@H]1C2)[C@H]1C[C@@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C39H48P2/c1-27(40(38-25-28-19-21-30(38)23-28)39-26-29-20-22-31(39)24-29)34-16-10-17-35(34)36-15-8-9-18-37(36)41(32-11-4-2-5-12-32)33-13-6-3-7-14-33/h2-9,11-15,18,27-31,34-35,38-39H,10,16-17,19-26H2,1H3/t27-,28-,29-,30+,31+,34?,35?,38-,39+,40?/m1/s1 |
| InChIKey | KFFBAYPLYMPJFE-XEVUOKFZSA-N |
| XLogP | 9.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.76 |
| LogP ≤ 5 | 9.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|