C19H21P — CID 102055643
[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]-diphenylphosphane (PubChem CID 102055643) has the molecular formula C19H21P and a molecular weight of 280.35 g/mol. Its IUPAC name is [(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]-diphenylphosphane.
| Compound Name | [(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]-diphenylphosphane |
|---|---|
| PubChem CID | 102055643 |
| Molecular Formula | C19H21P |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | [(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]-diphenylphosphane |
| SMILES | c1ccc(P(c2ccccc2)[C@H]2C[C@@H]3CC[C@@H]2C3)cc1 |
| InChI | InChI=1S/C19H21P/c1-3-7-17(8-4-1)20(18-9-5-2-6-10-18)19-14-15-11-12-16(19)13-15/h1-10,15-16,19H,11-14H2/t15-,16-,19+/m1/s1 |
| InChIKey | OLZZPWBKRIFEJN-MDZRGWNJSA-N |
| XLogP | 4.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|