C33H34P2 — CID 13296398
[(1R,2R,3S,4S)-3-(diphenylphosphanylmethyl)-2-bicyclo[2.2.1]heptanyl]methyl-diphenylphosphane (PubChem CID 13296398) has the molecular formula C33H34P2 and a molecular weight of 492.58 g/mol. Its IUPAC name is [(1R,2R,3S,4S)-3-(diphenylphosphanylmethyl)-2-bicyclo[2.2.1]heptanyl]methyl-diphenylphosphane.
| Compound Name | [(1R,2R,3S,4S)-3-(diphenylphosphanylmethyl)-2-bicyclo[2.2.1]heptanyl]methyl-diphenylphosphane |
|---|---|
| PubChem CID | 13296398 |
| Molecular Formula | C33H34P2 |
| Molecular Weight | 492.58 g/mol |
| Exact Mass | 492.21 |
| IUPAC Name | [(1R,2R,3S,4S)-3-(diphenylphosphanylmethyl)-2-bicyclo[2.2.1]heptanyl]methyl-diphenylphosphane |
| SMILES | c1ccc(P(C[C@@H]2[C@@H]3CC[C@@H](C3)[C@@H]2CP(c2ccccc2)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C33H34P2/c1-5-13-28(14-6-1)34(29-15-7-2-8-16-29)24-32-26-21-22-27(23-26)33(32)25-35(30-17-9-3-10-18-30)31-19-11-4-12-20-31/h1-20,26-27,32-33H,21-25H2/t26-,27+,32-,33+ |
| InChIKey | YZOJQTFUSMOBTF-XZYRDJQFSA-N |
| XLogP | 6.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.58 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|