C57H54P4 — CID 134865357
diphenyl-[[(1S,2S,3R)-2,3,4-tris(diphenylphosphanylmethyl)cyclopentyl]methyl]phosphane (PubChem CID 134865357) has the molecular formula C57H54P4 and a molecular weight of 862.96 g/mol. Its IUPAC name is diphenyl-[[(1S,2S,3R)-2,3,4-tris(diphenylphosphanylmethyl)cyclopentyl]methyl]phosphane.
| Compound Name | diphenyl-[[(1S,2S,3R)-2,3,4-tris(diphenylphosphanylmethyl)cyclopentyl]methyl]phosphane |
|---|---|
| PubChem CID | 134865357 |
| Molecular Formula | C57H54P4 |
| Molecular Weight | 862.96 g/mol |
| Exact Mass | 862.32 |
| IUPAC Name | diphenyl-[[(1S,2S,3R)-2,3,4-tris(diphenylphosphanylmethyl)cyclopentyl]methyl]phosphane |
| SMILES | c1ccc(P(CC2C[C@H](CP(c3ccccc3)c3ccccc3)[C@H](CP(c3ccccc3)c3ccccc3)[C@@H]2CP(c2ccccc2)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C57H54P4/c1-9-25-48(26-10-1)58(49-27-11-2-12-28-49)42-46-41-47(43-59(50-29-13-3-14-30-50)51-31-15-4-16-32-51)57(45-61(54-37-21-7-22-38-54)55-39-23-8-24-40-55)56(46)44-60(52-33-17-5-18-34-52)53-35-19-6-20-36-53/h1-40,46-47,56-57H,41-45H2/t46-,47?,56+,57-/m1/s1 |
| InChIKey | HYAJCBCVJRLTRN-GPUQHDAKSA-N |
| XLogP | 11.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 16 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 862.96 |
| LogP ≤ 5 | 11.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|