C19H19P — CID 129111578
[(1S,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]-diphenylphosphane (PubChem CID 129111578) has the molecular formula C19H19P and a molecular weight of 278.34 g/mol. Its IUPAC name is [(1S,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]-diphenylphosphane.
| Compound Name | [(1S,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]-diphenylphosphane |
|---|---|
| PubChem CID | 129111578 |
| Molecular Formula | C19H19P |
| Molecular Weight | 278.34 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | [(1S,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]-diphenylphosphane |
| SMILES | C1=C[C@@H]2C[C@H]1C[C@H]2P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H19P/c1-3-7-17(8-4-1)20(18-9-5-2-6-10-18)19-14-15-11-12-16(19)13-15/h1-12,15-16,19H,13-14H2/t15-,16+,19+/m0/s1 |
| InChIKey | OVAVIAQUJRQCNE-FRQCXROJSA-N |
| XLogP | 4.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.34 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|