C13H14 — CID 98052947
(1S,4R,5S)-5-phenylbicyclo[2.2.1]hept-2-ene (PubChem CID 98052947) has the molecular formula C13H14 and a molecular weight of 170.25 g/mol. Its IUPAC name is (1S,4R,5S)-5-phenylbicyclo[2.2.1]hept-2-ene.
| Compound Name | (1S,4R,5S)-5-phenylbicyclo[2.2.1]hept-2-ene |
|---|---|
| PubChem CID | 98052947 |
| Molecular Formula | C13H14 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | (1S,4R,5S)-5-phenylbicyclo[2.2.1]hept-2-ene |
| SMILES | C1=C[C@H]2C[C@H]1C[C@@H]2c1ccccc1 |
| InChI | InChI=1S/C13H14/c1-2-4-11(5-3-1)13-9-10-6-7-12(13)8-10/h1-7,10,12-13H,8-9H2/t10-,12-,13+/m0/s1 |
| InChIKey | PGNNHYNYFLXKDZ-WCFLWFBJSA-N |
| XLogP | 3.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|