C27H24 — CID 95931340
(1S,4S,5R,8R)-2,4,8-triphenylbicyclo[3.3.1]nona-2,6-diene (PubChem CID 95931340) has the molecular formula C27H24 and a molecular weight of 348.49 g/mol. Its IUPAC name is (1S,4S,5R,8R)-2,4,8-triphenylbicyclo[3.3.1]nona-2,6-diene.
| Compound Name | (1S,4S,5R,8R)-2,4,8-triphenylbicyclo[3.3.1]nona-2,6-diene |
|---|---|
| PubChem CID | 95931340 |
| Molecular Formula | C27H24 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | (1S,4S,5R,8R)-2,4,8-triphenylbicyclo[3.3.1]nona-2,6-diene |
| SMILES | C1=C[C@@H](c2ccccc2)[C@@H]2C[C@H]1[C@H](c1ccccc1)C=C2c1ccccc1 |
| InChI | InChI=1S/C27H24/c1-4-10-20(11-5-1)24-17-16-23-18-27(24)26(22-14-8-3-9-15-22)19-25(23)21-12-6-2-7-13-21/h1-17,19,23-25,27H,18H2/t23-,24-,25-,27-/m0/s1 |
| InChIKey | LOKYGBYSTJTZQN-XLXZRNDBSA-N |
| XLogP | 6.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|