About 3-phenyltricyclo[5.2.1.02,6]deca-3,8-diene
3-phenyltricyclo[5.2.1.02,6]deca-3,8-diene (PubChem CID 75242817) has the molecular formula C16H16
and a molecular weight of 208.30 g/mol. Its IUPAC name is 3-phenyltricyclo[5.2.1.02,6]deca-3,8-diene.
Molecular Properties
| Compound Name | 3-phenyltricyclo[5.2.1.02,6]deca-3,8-diene |
| PubChem CID | 75242817 |
| Molecular Formula | C16H16 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | 3-phenyltricyclo[5.2.1.02,6]deca-3,8-diene |
| SMILES | C1=CC2CC1C1CC=C(c3ccccc3)C21 |
| InChI | InChI=1S/C16H16/c1-2-4-11(5-3-1)14-8-9-15-12-6-7-13(10-12)16(14)15/h1-8,12-13,15-16H,9-10H2 |
| InChIKey | GNQXMPSPMMWTKI-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-phenyltricyclo[5.2.1.02,6]deca-3,8-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenyltricyclo[5.2.1.02,6]deca-3,8-diene?
The IUPAC name of 3-phenyltricyclo[5.2.1.02,6]deca-3,8-diene (CID 75242817) is 3-phenyltricyclo[5.2.1.02,6]deca-3,8-diene.
What is the SMILES notation for 3-phenyltricyclo[5.2.1.02,6]deca-3,8-diene?
The canonical SMILES for 3-phenyltricyclo[5.2.1.02,6]deca-3,8-diene is C1=CC2CC1C1CC=C(c3ccccc3)C21.
What is the InChIKey of 3-phenyltricyclo[5.2.1.02,6]deca-3,8-diene?
The InChIKey is GNQXMPSPMMWTKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16/c1-2-4-11(5-3-1)14-8-9-15-12-6-7-13(10-12)16(14)15/h1-8,12-13,15-16H,9-10H2.
What are the key properties of 3-phenyltricyclo[5.2.1.02,6]deca-3,8-diene?
3-phenyltricyclo[5.2.1.02,6]deca-3,8-diene has a molecular weight of 208.30 g/mol, XLogP of 3.91, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenyltricyclo[5.2.1.02,6]deca-3,8-diene is sourced from PubChem (CID 75242817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).