C22H22 — CID 102399204
(1R,5R)-2,6-diphenylbicyclo[3.3.2]deca-2,6-diene (PubChem CID 102399204) has the molecular formula C22H22 and a molecular weight of 286.42 g/mol. Its IUPAC name is (1R,5R)-2,6-diphenylbicyclo[3.3.2]deca-2,6-diene.
| Compound Name | (1R,5R)-2,6-diphenylbicyclo[3.3.2]deca-2,6-diene |
|---|---|
| PubChem CID | 102399204 |
| Molecular Formula | C22H22 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | (1R,5R)-2,6-diphenylbicyclo[3.3.2]deca-2,6-diene |
| SMILES | C1=C(c2ccccc2)[C@H]2CC=C(c3ccccc3)[C@@H](C1)CC2 |
| InChI | InChI=1S/C22H22/c1-3-7-17(8-4-1)21-15-13-20-12-11-19(21)14-16-22(20)18-9-5-2-6-10-18/h1-10,15-16,19-20H,11-14H2/t19-,20-/m1/s1 |
| InChIKey | ATQJRMGDSQUYAG-WOJBJXKFSA-N |
| XLogP | 5.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |