C16H22O — CID 130290357
(1R,5S,6R,7R)-5,6,7-trimethyl-4-phenylcyclohept-3-en-1-ol (PubChem CID 130290357) has the molecular formula C16H22O and a molecular weight of 230.35 g/mol. Its IUPAC name is (1R,5S,6R,7R)-5,6,7-trimethyl-4-phenylcyclohept-3-en-1-ol.
| Compound Name | (1R,5S,6R,7R)-5,6,7-trimethyl-4-phenylcyclohept-3-en-1-ol |
|---|---|
| PubChem CID | 130290357 |
| Molecular Formula | C16H22O |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | (1R,5S,6R,7R)-5,6,7-trimethyl-4-phenylcyclohept-3-en-1-ol |
| SMILES | C[C@@H]1[C@H](C)[C@H](C)C(c2ccccc2)=CC[C@H]1O |
| InChI | InChI=1S/C16H22O/c1-11-12(2)15(9-10-16(17)13(11)3)14-7-5-4-6-8-14/h4-9,11-13,16-17H,10H2,1-3H3/t11-,12+,13-,16-/m1/s1 |
| InChIKey | IEWHRYFPGIAHLM-OQMKEHIESA-N |
| XLogP | 3.74 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |