C17H24O2S — CID 159799333
sulfur dioxide;(4R,5S,6S,7S)-4,5,6,7-tetramethyl-1-phenylcycloheptene (PubChem CID 159799333) has the molecular formula C17H24O2S and a molecular weight of 292.44 g/mol. Its IUPAC name is sulfur dioxide;(4R,5S,6S,7S)-4,5,6,7-tetramethyl-1-phenylcycloheptene.
| Compound Name | sulfur dioxide;(4R,5S,6S,7S)-4,5,6,7-tetramethyl-1-phenylcycloheptene |
|---|---|
| PubChem CID | 159799333 |
| Molecular Formula | C17H24O2S |
| Molecular Weight | 292.44 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | sulfur dioxide;(4R,5S,6S,7S)-4,5,6,7-tetramethyl-1-phenylcycloheptene |
| SMILES | C[C@@H]1[C@H](C)[C@H](C)C(c2ccccc2)=CC[C@H]1C.O=S=O |
| InChI | InChI=1S/C17H24.O2S/c1-12-10-11-17(15(4)14(3)13(12)2)16-8-6-5-7-9-16;1-3-2/h5-9,11-15H,10H2,1-4H3;/t12-,13+,14+,15+;/m1./s1 |
| InChIKey | NJOVJYSWMQOVLA-SJFOYXCYSA-N |
| XLogP | 4.35 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.44 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |