C19H20 — CID 101214144
[(3S,4S)-3,4-dimethyl-2-phenylcyclopenten-1-yl]benzene (PubChem CID 101214144) has the molecular formula C19H20 and a molecular weight of 248.37 g/mol. Its IUPAC name is [(3S,4S)-3,4-dimethyl-2-phenylcyclopenten-1-yl]benzene.
| Compound Name | [(3S,4S)-3,4-dimethyl-2-phenylcyclopenten-1-yl]benzene |
|---|---|
| PubChem CID | 101214144 |
| Molecular Formula | C19H20 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | [(3S,4S)-3,4-dimethyl-2-phenylcyclopenten-1-yl]benzene |
| SMILES | C[C@@H]1C(c2ccccc2)=C(c2ccccc2)C[C@@H]1C |
| InChI | InChI=1S/C19H20/c1-14-13-18(16-9-5-3-6-10-16)19(15(14)2)17-11-7-4-8-12-17/h3-12,14-15H,13H2,1-2H3/t14-,15-/m0/s1 |
| InChIKey | PKZNVGVFHPNNEV-GJZGRUSLSA-N |
| XLogP | 5.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|