C13H14O — CID 139667447
4,5-dimethyl-3-phenylcyclopent-2-en-1-one (PubChem CID 139667447) has the molecular formula C13H14O and a molecular weight of 186.25 g/mol. Its IUPAC name is 4,5-dimethyl-3-phenylcyclopent-2-en-1-one.
| Compound Name | 4,5-dimethyl-3-phenylcyclopent-2-en-1-one |
|---|---|
| PubChem CID | 139667447 |
| Molecular Formula | C13H14O |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.10 |
| IUPAC Name | 4,5-dimethyl-3-phenylcyclopent-2-en-1-one |
| SMILES | CC1C(=O)C=C(c2ccccc2)C1C |
| InChI | InChI=1S/C13H14O/c1-9-10(2)13(14)8-12(9)11-6-4-3-5-7-11/h3-10H,1-2H3 |
| InChIKey | BGOOXUUJPORWGY-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |