C15H20NOP — CID 174729420
1,1'-biphenyl;N,N-dimethylmethanamine;oxophosphane (PubChem CID 174729420) has the molecular formula C15H20NOP and a molecular weight of 261.31 g/mol. Its IUPAC name is 1,1'-biphenyl;N,N-dimethylmethanamine;oxophosphane.
| Compound Name | 1,1'-biphenyl;N,N-dimethylmethanamine;oxophosphane |
|---|---|
| PubChem CID | 174729420 |
| Molecular Formula | C15H20NOP |
| Molecular Weight | 261.31 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | 1,1'-biphenyl;N,N-dimethylmethanamine;oxophosphane |
| SMILES | CN(C)C.O=P.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.C3H9N.HOP/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-4(2)3;1-2/h1-10H;1-3H3;2H |
| InChIKey | XOPBDFNOZPULMD-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.31 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|