About 1,1'-biphenyl;N,N-dimethylmethanamine;oxophosphane
1,1'-biphenyl;N,N-dimethylmethanamine;oxophosphane (PubChem CID 174729420) has the molecular formula C15H20NOP
and a molecular weight of 261.31 g/mol. Its IUPAC name is 1,1'-biphenyl;N,N-dimethylmethanamine;oxophosphane.
Molecular Properties
| Compound Name | 1,1'-biphenyl;N,N-dimethylmethanamine;oxophosphane |
| PubChem CID | 174729420 |
| Molecular Formula | C15H20NOP |
| Molecular Weight | 261.31 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | 1,1'-biphenyl;N,N-dimethylmethanamine;oxophosphane |
| SMILES | CN(C)C.O=P.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.C3H9N.HOP/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-4(2)3;1-2/h1-10H;1-3H3;2H |
| InChIKey | XOPBDFNOZPULMD-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.31 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1,1'-biphenyl;N,N-dimethylmethanamine;oxophosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1'-biphenyl;N,N-dimethylmethanamine;oxophosphane?
The IUPAC name of 1,1'-biphenyl;N,N-dimethylmethanamine;oxophosphane (CID 174729420) is 1,1'-biphenyl;N,N-dimethylmethanamine;oxophosphane.
What is the SMILES notation for 1,1'-biphenyl;N,N-dimethylmethanamine;oxophosphane?
The canonical SMILES for 1,1'-biphenyl;N,N-dimethylmethanamine;oxophosphane is CN(C)C.O=P.c1ccc(-c2ccccc2)cc1.
What is the InChIKey of 1,1'-biphenyl;N,N-dimethylmethanamine;oxophosphane?
The InChIKey is XOPBDFNOZPULMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10.C3H9N.HOP/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-4(2)3;1-2/h1-10H;1-3H3;2H.
What are the key properties of 1,1'-biphenyl;N,N-dimethylmethanamine;oxophosphane?
1,1'-biphenyl;N,N-dimethylmethanamine;oxophosphane has a molecular weight of 261.31 g/mol, XLogP of 4.01, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1'-biphenyl;N,N-dimethylmethanamine;oxophosphane is sourced from PubChem (CID 174729420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).