C8H10O2 — CID 130037029
5,6-dimethylcyclohex-2-ene-1,4-dione (PubChem CID 130037029) has the molecular formula C8H10O2 and a molecular weight of 138.17 g/mol. Its IUPAC name is 5,6-dimethylcyclohex-2-ene-1,4-dione.
| Compound Name | 5,6-dimethylcyclohex-2-ene-1,4-dione |
|---|---|
| PubChem CID | 130037029 |
| Molecular Formula | C8H10O2 |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.07 |
| IUPAC Name | 5,6-dimethylcyclohex-2-ene-1,4-dione |
| SMILES | CC1C(=O)C=CC(=O)C1C |
| InChI | InChI=1S/C8H10O2/c1-5-6(2)8(10)4-3-7(5)9/h3-6H,1-2H3 |
| InChIKey | XTPLABZANFXAQG-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |