C7H10O2 — CID 10749188
(2R,6S)-2,6-dimethyl-2H-pyran-5-one (PubChem CID 10749188) has the molecular formula C7H10O2 and a molecular weight of 126.15 g/mol. Its IUPAC name is (2R,6S)-2,6-dimethyl-2H-pyran-5-one.
| Compound Name | (2R,6S)-2,6-dimethyl-2H-pyran-5-one |
|---|---|
| PubChem CID | 10749188 |
| Molecular Formula | C7H10O2 |
| Molecular Weight | 126.15 g/mol |
| Exact Mass | 126.07 |
| IUPAC Name | (2R,6S)-2,6-dimethyl-2H-pyran-5-one |
| SMILES | C[C@@H]1C=CC(=O)[C@H](C)O1 |
| InChI | InChI=1S/C7H10O2/c1-5-3-4-7(8)6(2)9-5/h3-6H,1-2H3/t5-,6+/m1/s1 |
| InChIKey | ZJTOOLLBLOGTDH-RITPCOANSA-N |
| XLogP | 0.92 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.15 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |