C13H12O4 — CID 24814897
[(2S,6S)-6-methyl-5-oxo-2H-pyran-2-yl] benzoate (PubChem CID 24814897) has the molecular formula C13H12O4 and a molecular weight of 232.23 g/mol. Its IUPAC name is [(2S,6S)-6-methyl-5-oxo-2H-pyran-2-yl] benzoate.
| Compound Name | [(2S,6S)-6-methyl-5-oxo-2H-pyran-2-yl] benzoate |
|---|---|
| PubChem CID | 24814897 |
| Molecular Formula | C13H12O4 |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | [(2S,6S)-6-methyl-5-oxo-2H-pyran-2-yl] benzoate |
| SMILES | C[C@@H]1O[C@@H](OC(=O)c2ccccc2)C=CC1=O |
| InChI | InChI=1S/C13H12O4/c1-9-11(14)7-8-12(16-9)17-13(15)10-5-3-2-4-6-10/h2-9,12H,1H3/t9-,12-/m0/s1 |
| InChIKey | GOXOINBFYKTXQN-CABZTGNLSA-N |
| XLogP | 1.71 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |