C19H28O5Si — CID 10832617
[(2R,3S,6R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-hydroxy-3,6-dihydro-2H-pyran-6-yl] benzoate (PubChem CID 10832617) has the molecular formula C19H28O5Si and a molecular weight of 364.51 g/mol. Its IUPAC name is [(2R,3S,6R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-hydroxy-3,6-dihydro-2H-pyran-6-yl] benzoate.
| Compound Name | [(2R,3S,6R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-hydroxy-3,6-dihydro-2H-pyran-6-yl] benzoate |
|---|---|
| PubChem CID | 10832617 |
| Molecular Formula | C19H28O5Si |
| Molecular Weight | 364.51 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | [(2R,3S,6R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-hydroxy-3,6-dihydro-2H-pyran-6-yl] benzoate |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](OC(=O)c2ccccc2)C=C[C@@H]1O |
| InChI | InChI=1S/C19H28O5Si/c1-19(2,3)25(4,5)22-13-16-15(20)11-12-17(23-16)24-18(21)14-9-7-6-8-10-14/h6-12,15-17,20H,13H2,1-5H3/t15-,16+,17+/m0/s1 |
| InChIKey | ZDBVKVIKEDHWPA-GVDBMIGSSA-N |
| XLogP | 3.51 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.51 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|