C17H28O4Si — CID 54754367
(2R,3R,4S,5S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-phenyloxolane-3,4-diol (PubChem CID 54754367) has the molecular formula C17H28O4Si and a molecular weight of 324.49 g/mol. Its IUPAC name is (2R,3R,4S,5S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-phenyloxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-phenyloxolane-3,4-diol |
|---|---|
| PubChem CID | 54754367 |
| Molecular Formula | C17H28O4Si |
| Molecular Weight | 324.49 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | (2R,3R,4S,5S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-phenyloxolane-3,4-diol |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](c2ccccc2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C17H28O4Si/c1-17(2,3)22(4,5)20-11-13-14(18)15(19)16(21-13)12-9-7-6-8-10-12/h6-10,13-16,18-19H,11H2,1-5H3/t13-,14+,15+,16+/m1/s1 |
| InChIKey | LWLDFWRLICEWSN-UGUYLWEFSA-N |
| XLogP | 2.87 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.49 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|