C8H11NO4 — CID 15084207
[(2R,6R)-6-methyl-5-oxo-2H-pyran-2-yl] N-methylcarbamate (PubChem CID 15084207) has the molecular formula C8H11NO4 and a molecular weight of 185.18 g/mol. Its IUPAC name is [(2R,6R)-6-methyl-5-oxo-2H-pyran-2-yl] N-methylcarbamate.
| Compound Name | [(2R,6R)-6-methyl-5-oxo-2H-pyran-2-yl] N-methylcarbamate |
|---|---|
| PubChem CID | 15084207 |
| Molecular Formula | C8H11NO4 |
| Molecular Weight | 185.18 g/mol |
| Exact Mass | 185.07 |
| IUPAC Name | [(2R,6R)-6-methyl-5-oxo-2H-pyran-2-yl] N-methylcarbamate |
| SMILES | CNC(=O)O[C@@H]1C=CC(=O)[C@@H](C)O1 |
| InChI | InChI=1S/C8H11NO4/c1-5-6(10)3-4-7(12-5)13-8(11)9-2/h3-5,7H,1-2H3,(H,9,11)/t5-,7-/m1/s1 |
| InChIKey | NXLVIKNRPKJXPQ-IYSWYEEDSA-N |
| XLogP | 0.21 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.18 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |