methyl 5-methoxy-2-methyl-2,5-dihydrofuran-3-carboxylate

C8H12O4 — CID 135006582

IUPACmethyl 5-methoxy-2-methyl-2,5-dihydrofuran-3-carboxylate
SMILESCOC(=O)C1=CC(OC)OC1C
InChIInChI=1S/C8H12O4/c1-5-6(8(9)11-3)4-7(10-2)12-5/h4-5,7H,1-3H3
InChIKeyVPZJIQGJSFGSDJ-UHFFFAOYSA-N
MW172.18 g/mol
LogP0.48
Rot. Bonds2

About methyl 5-methoxy-2-methyl-2,5-dihydrofuran-3-carboxylate

methyl 5-methoxy-2-methyl-2,5-dihydrofuran-3-carboxylate (PubChem CID 135006582) has the molecular formula C8H12O4 and a molecular weight of 172.18 g/mol. Its IUPAC name is methyl 5-methoxy-2-methyl-2,5-dihydrofuran-3-carboxylate.

Molecular Properties

Compound Namemethyl 5-methoxy-2-methyl-2,5-dihydrofuran-3-carboxylate
PubChem CID135006582
Molecular FormulaC8H12O4
Molecular Weight172.18 g/mol
Exact Mass172.07
IUPAC Namemethyl 5-methoxy-2-methyl-2,5-dihydrofuran-3-carboxylate
SMILESCOC(=O)C1=CC(OC)OC1C
InChIInChI=1S/C8H12O4/c1-5-6(8(9)11-3)4-7(10-2)12-5/h4-5,7H,1-3H3
InChIKeyVPZJIQGJSFGSDJ-UHFFFAOYSA-N
XLogP0.48
TPSA44.76 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500172.18
LogP ≤ 50.48
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 5-methoxy-2-methyl-2,5-dihydrofuran-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 5-methoxy-2-methyl-2,5-dihydrofuran-3-carboxylate?
The IUPAC name of methyl 5-methoxy-2-methyl-2,5-dihydrofuran-3-carboxylate (CID 135006582) is methyl 5-methoxy-2-methyl-2,5-dihydrofuran-3-carboxylate.
What is the SMILES notation for methyl 5-methoxy-2-methyl-2,5-dihydrofuran-3-carboxylate?
The canonical SMILES for methyl 5-methoxy-2-methyl-2,5-dihydrofuran-3-carboxylate is COC(=O)C1=CC(OC)OC1C.
What is the InChIKey of methyl 5-methoxy-2-methyl-2,5-dihydrofuran-3-carboxylate?
The InChIKey is VPZJIQGJSFGSDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O4/c1-5-6(8(9)11-3)4-7(10-2)12-5/h4-5,7H,1-3H3.
What are the key properties of methyl 5-methoxy-2-methyl-2,5-dihydrofuran-3-carboxylate?
methyl 5-methoxy-2-methyl-2,5-dihydrofuran-3-carboxylate has a molecular weight of 172.18 g/mol, XLogP of 0.48, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-methoxy-2-methyl-2,5-dihydrofuran-3-carboxylate is sourced from PubChem (CID 135006582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).