C7H9ClO3 — CID 130891459
(2S,6S)-4-chloro-2-methoxy-6-methyl-2H-pyran-5-one (PubChem CID 130891459) has the molecular formula C7H9ClO3 and a molecular weight of 176.60 g/mol. Its IUPAC name is (2S,6S)-4-chloro-2-methoxy-6-methyl-2H-pyran-5-one.
| Compound Name | (2S,6S)-4-chloro-2-methoxy-6-methyl-2H-pyran-5-one |
|---|---|
| PubChem CID | 130891459 |
| Molecular Formula | C7H9ClO3 |
| Molecular Weight | 176.60 g/mol |
| Exact Mass | 176.02 |
| IUPAC Name | (2S,6S)-4-chloro-2-methoxy-6-methyl-2H-pyran-5-one |
| SMILES | CO[C@@H]1C=C(Cl)C(=O)[C@H](C)O1 |
| InChI | InChI=1S/C7H9ClO3/c1-4-7(9)5(8)3-6(10-2)11-4/h3-4,6H,1-2H3/t4-,6-/m0/s1 |
| InChIKey | DHPZIGNTAGIVKP-NJGYIYPDSA-N |
| XLogP | 1.07 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.60 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|