C8H12O4 — CID 170990689
(2R,6S)-4,6-dimethoxy-2-methyl-2H-pyran-5-one (PubChem CID 170990689) has the molecular formula C8H12O4 and a molecular weight of 172.18 g/mol. Its IUPAC name is (2R,6S)-4,6-dimethoxy-2-methyl-2H-pyran-5-one.
| Compound Name | (2R,6S)-4,6-dimethoxy-2-methyl-2H-pyran-5-one |
|---|---|
| PubChem CID | 170990689 |
| Molecular Formula | C8H12O4 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | (2R,6S)-4,6-dimethoxy-2-methyl-2H-pyran-5-one |
| SMILES | COC1=C[C@@H](C)O[C@H](OC)C1=O |
| InChI | InChI=1S/C8H12O4/c1-5-4-6(10-2)7(9)8(11-3)12-5/h4-5,8H,1-3H3/t5-,8+/m1/s1 |
| InChIKey | FZPAACPQPKSUDG-XRGYYRRGSA-N |
| XLogP | 0.48 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |