C9H12O3 — CID 142171284
2,6-dimethoxy-4-methylcyclohexa-2,5-dien-1-one (PubChem CID 142171284) has the molecular formula C9H12O3 and a molecular weight of 168.19 g/mol. Its IUPAC name is 2,6-dimethoxy-4-methylcyclohexa-2,5-dien-1-one.
| Compound Name | 2,6-dimethoxy-4-methylcyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 142171284 |
| Molecular Formula | C9H12O3 |
| Molecular Weight | 168.19 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | 2,6-dimethoxy-4-methylcyclohexa-2,5-dien-1-one |
| SMILES | COC1=CC(C)C=C(OC)C1=O |
| InChI | InChI=1S/C9H12O3/c1-6-4-7(11-2)9(10)8(5-6)12-3/h4-6H,1-3H3 |
| InChIKey | DAGNGTPBDUQXJB-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.19 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |