C10H14O2 — CID 170731638
2,3-dimethoxy-7-methylcyclohepta-1,3,5-triene (PubChem CID 170731638) has the molecular formula C10H14O2 and a molecular weight of 166.22 g/mol. Its IUPAC name is 2,3-dimethoxy-7-methylcyclohepta-1,3,5-triene.
| Compound Name | 2,3-dimethoxy-7-methylcyclohepta-1,3,5-triene |
|---|---|
| PubChem CID | 170731638 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | 2,3-dimethoxy-7-methylcyclohepta-1,3,5-triene |
| SMILES | COC1=CC=CC(C)C=C1OC |
| InChI | InChI=1S/C10H14O2/c1-8-5-4-6-9(11-2)10(7-8)12-3/h4-8H,1-3H3 |
| InChIKey | ALVNPMYDPHWCPY-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |