About ethane;2-(4-methoxyphenoxy)-7-methylcyclohepta-1,3,5-triene
ethane;2-(4-methoxyphenoxy)-7-methylcyclohepta-1,3,5-triene (PubChem CID 143418654) has the molecular formula C17H22O2
and a molecular weight of 258.36 g/mol. Its IUPAC name is ethane;2-(4-methoxyphenoxy)-7-methylcyclohepta-1,3,5-triene.
Molecular Properties
| Compound Name | ethane;2-(4-methoxyphenoxy)-7-methylcyclohepta-1,3,5-triene |
| PubChem CID | 143418654 |
| Molecular Formula | C17H22O2 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | ethane;2-(4-methoxyphenoxy)-7-methylcyclohepta-1,3,5-triene |
| SMILES | CC.COc1ccc(OC2=CC(C)C=CC=C2)cc1 |
| InChI | InChI=1S/C15H16O2.C2H6/c1-12-5-3-4-6-15(11-12)17-14-9-7-13(16-2)8-10-14;1-2/h3-12H,1-2H3;1-2H3 |
| InChIKey | QVHGQMBAMCBQIG-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;2-(4-methoxyphenoxy)-7-methylcyclohepta-1,3,5-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-(4-methoxyphenoxy)-7-methylcyclohepta-1,3,5-triene?
The IUPAC name of ethane;2-(4-methoxyphenoxy)-7-methylcyclohepta-1,3,5-triene (CID 143418654) is ethane;2-(4-methoxyphenoxy)-7-methylcyclohepta-1,3,5-triene.
What is the SMILES notation for ethane;2-(4-methoxyphenoxy)-7-methylcyclohepta-1,3,5-triene?
The canonical SMILES for ethane;2-(4-methoxyphenoxy)-7-methylcyclohepta-1,3,5-triene is CC.COc1ccc(OC2=CC(C)C=CC=C2)cc1.
What is the InChIKey of ethane;2-(4-methoxyphenoxy)-7-methylcyclohepta-1,3,5-triene?
The InChIKey is QVHGQMBAMCBQIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16O2.C2H6/c1-12-5-3-4-6-15(11-12)17-14-9-7-13(16-2)8-10-14;1-2/h3-12H,1-2H3;1-2H3.
What are the key properties of ethane;2-(4-methoxyphenoxy)-7-methylcyclohepta-1,3,5-triene?
ethane;2-(4-methoxyphenoxy)-7-methylcyclohepta-1,3,5-triene has a molecular weight of 258.36 g/mol, XLogP of 4.75, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-(4-methoxyphenoxy)-7-methylcyclohepta-1,3,5-triene is sourced from PubChem (CID 143418654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).