About ethane;7-methyl-2-methylsulfanyl-3-prop-1-en-2-ylcyclohepta-1,3,5-triene
ethane;7-methyl-2-methylsulfanyl-3-prop-1-en-2-ylcyclohepta-1,3,5-triene (PubChem CID 142148820) has the molecular formula C14H22S
and a molecular weight of 222.40 g/mol. Its IUPAC name is ethane;7-methyl-2-methylsulfanyl-3-prop-1-en-2-ylcyclohepta-1,3,5-triene.
Molecular Properties
| Compound Name | ethane;7-methyl-2-methylsulfanyl-3-prop-1-en-2-ylcyclohepta-1,3,5-triene |
| PubChem CID | 142148820 |
| Molecular Formula | C14H22S |
| Molecular Weight | 222.40 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | ethane;7-methyl-2-methylsulfanyl-3-prop-1-en-2-ylcyclohepta-1,3,5-triene |
| SMILES | C=C(C)C1=CC=CC(C)C=C1SC.CC |
| InChI | InChI=1S/C12H16S.C2H6/c1-9(2)11-7-5-6-10(3)8-12(11)13-4;1-2/h5-8,10H,1H2,2-4H3;1-2H3 |
| InChIKey | PAEWBTGCUZMCOJ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.40 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;7-methyl-2-methylsulfanyl-3-prop-1-en-2-ylcyclohepta-1,3,5-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;7-methyl-2-methylsulfanyl-3-prop-1-en-2-ylcyclohepta-1,3,5-triene?
The IUPAC name of ethane;7-methyl-2-methylsulfanyl-3-prop-1-en-2-ylcyclohepta-1,3,5-triene (CID 142148820) is ethane;7-methyl-2-methylsulfanyl-3-prop-1-en-2-ylcyclohepta-1,3,5-triene.
What is the SMILES notation for ethane;7-methyl-2-methylsulfanyl-3-prop-1-en-2-ylcyclohepta-1,3,5-triene?
The canonical SMILES for ethane;7-methyl-2-methylsulfanyl-3-prop-1-en-2-ylcyclohepta-1,3,5-triene is C=C(C)C1=CC=CC(C)C=C1SC.CC.
What is the InChIKey of ethane;7-methyl-2-methylsulfanyl-3-prop-1-en-2-ylcyclohepta-1,3,5-triene?
The InChIKey is PAEWBTGCUZMCOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16S.C2H6/c1-9(2)11-7-5-6-10(3)8-12(11)13-4;1-2/h5-8,10H,1H2,2-4H3;1-2H3.
What are the key properties of ethane;7-methyl-2-methylsulfanyl-3-prop-1-en-2-ylcyclohepta-1,3,5-triene?
ethane;7-methyl-2-methylsulfanyl-3-prop-1-en-2-ylcyclohepta-1,3,5-triene has a molecular weight of 222.40 g/mol, XLogP of 4.97, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;7-methyl-2-methylsulfanyl-3-prop-1-en-2-ylcyclohepta-1,3,5-triene is sourced from PubChem (CID 142148820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).