C15H17FS — CID 170063910
3-[(1E,3Z)-1-fluoropenta-1,3-dienyl]-2,5,8,9-tetrahydro-1-benzothiepine (PubChem CID 170063910) has the molecular formula C15H17FS and a molecular weight of 248.37 g/mol. Its IUPAC name is 3-[(1E,3Z)-1-fluoropenta-1,3-dienyl]-2,5,8,9-tetrahydro-1-benzothiepine.
| Compound Name | 3-[(1E,3Z)-1-fluoropenta-1,3-dienyl]-2,5,8,9-tetrahydro-1-benzothiepine |
|---|---|
| PubChem CID | 170063910 |
| Molecular Formula | C15H17FS |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 3-[(1E,3Z)-1-fluoropenta-1,3-dienyl]-2,5,8,9-tetrahydro-1-benzothiepine |
| SMILES | C/C=C\C=C(\F)C1=CCC2=C(CCC=C2)SC1 |
| InChI | InChI=1S/C15H17FS/c1-2-3-7-14(16)13-10-9-12-6-4-5-8-15(12)17-11-13/h2-4,6-7,10H,5,8-9,11H2,1H3/b3-2-,14-7+ |
| InChIKey | XAKFKZXCIUFGRS-HQHDCNBVSA-N |
| XLogP | 5.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|