C14H15F3S — CID 123796387
3,5-dimethyl-2-[4-(trifluoromethyl)hexa-1,3,5-trien-2-yl]-4H-thiopyran (PubChem CID 123796387) has the molecular formula C14H15F3S and a molecular weight of 272.34 g/mol. Its IUPAC name is 3,5-dimethyl-2-[4-(trifluoromethyl)hexa-1,3,5-trien-2-yl]-4H-thiopyran.
| Compound Name | 3,5-dimethyl-2-[4-(trifluoromethyl)hexa-1,3,5-trien-2-yl]-4H-thiopyran |
|---|---|
| PubChem CID | 123796387 |
| Molecular Formula | C14H15F3S |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 3,5-dimethyl-2-[4-(trifluoromethyl)hexa-1,3,5-trien-2-yl]-4H-thiopyran |
| SMILES | C=CC(=CC(=C)C1=C(C)CC(C)=CS1)C(F)(F)F |
| InChI | InChI=1S/C14H15F3S/c1-5-12(14(15,16)17)7-11(4)13-10(3)6-9(2)8-18-13/h5,7-8H,1,4,6H2,2-3H3 |
| InChIKey | KRSGERSWXWAQNL-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|