C11H17F3S — CID 125476027
(2E)-3,7-dimethyl-1-(trifluoromethylsulfanyl)octa-2,6-diene (PubChem CID 125476027) has the molecular formula C11H17F3S and a molecular weight of 238.32 g/mol. Its IUPAC name is (2E)-3,7-dimethyl-1-(trifluoromethylsulfanyl)octa-2,6-diene.
| Compound Name | (2E)-3,7-dimethyl-1-(trifluoromethylsulfanyl)octa-2,6-diene |
|---|---|
| PubChem CID | 125476027 |
| Molecular Formula | C11H17F3S |
| Molecular Weight | 238.32 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | (2E)-3,7-dimethyl-1-(trifluoromethylsulfanyl)octa-2,6-diene |
| SMILES | CC(C)=CCC/C(C)=C/CSC(F)(F)F |
| InChI | InChI=1S/C11H17F3S/c1-9(2)5-4-6-10(3)7-8-15-11(12,13)14/h5,7H,4,6,8H2,1-3H3/b10-7+ |
| InChIKey | DKOJVAGQWWDKJV-JXMROGBWSA-N |
| XLogP | 4.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.32 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|