C10H15F5S — CID 90955522
3-ethyl-4,4,5,5,5-pentafluoro-1-propylsulfanylpent-2-ene (PubChem CID 90955522) has the molecular formula C10H15F5S and a molecular weight of 262.29 g/mol. Its IUPAC name is 3-ethyl-4,4,5,5,5-pentafluoro-1-propylsulfanylpent-2-ene.
| Compound Name | 3-ethyl-4,4,5,5,5-pentafluoro-1-propylsulfanylpent-2-ene |
|---|---|
| PubChem CID | 90955522 |
| Molecular Formula | C10H15F5S |
| Molecular Weight | 262.29 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | 3-ethyl-4,4,5,5,5-pentafluoro-1-propylsulfanylpent-2-ene |
| SMILES | CCCSCC=C(CC)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H15F5S/c1-3-6-16-7-5-8(4-2)9(11,12)10(13,14)15/h5H,3-4,6-7H2,1-2H3 |
| InChIKey | SCEDYVDHAYGYNN-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.29 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|