C8H9ClO4 — CID 172805370
2,6-dimethoxycyclohexa-2,5-diene-1,4-dione;hydrochloride (PubChem CID 172805370) has the molecular formula C8H9ClO4 and a molecular weight of 204.61 g/mol. Its IUPAC name is 2,6-dimethoxycyclohexa-2,5-diene-1,4-dione;hydrochloride.
| Compound Name | 2,6-dimethoxycyclohexa-2,5-diene-1,4-dione;hydrochloride |
|---|---|
| PubChem CID | 172805370 |
| Molecular Formula | C8H9ClO4 |
| Molecular Weight | 204.61 g/mol |
| Exact Mass | 204.02 |
| IUPAC Name | 2,6-dimethoxycyclohexa-2,5-diene-1,4-dione;hydrochloride |
| SMILES | COC1=CC(=O)C=C(OC)C1=O.Cl |
| InChI | InChI=1S/C8H8O4.ClH/c1-11-6-3-5(9)4-7(12-2)8(6)10;/h3-4H,1-2H3;1H |
| InChIKey | RKYLTYUCVKECKP-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.61 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|