C13H11NO4S — CID 6324713
(NZ)-N-(2-methoxy-4-oxocyclohexa-2,5-dien-1-ylidene)benzenesulfonamide (PubChem CID 6324713) has the molecular formula C13H11NO4S and a molecular weight of 277.30 g/mol. Its IUPAC name is (NZ)-N-(2-methoxy-4-oxocyclohexa-2,5-dien-1-ylidene)benzenesulfonamide.
| Compound Name | (NZ)-N-(2-methoxy-4-oxocyclohexa-2,5-dien-1-ylidene)benzenesulfonamide |
|---|---|
| PubChem CID | 6324713 |
| Molecular Formula | C13H11NO4S |
| Molecular Weight | 277.30 g/mol |
| Exact Mass | 277.04 |
| IUPAC Name | (NZ)-N-(2-methoxy-4-oxocyclohexa-2,5-dien-1-ylidene)benzenesulfonamide |
| SMILES | COC1=CC(=O)C=C/C1=N/S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C13H11NO4S/c1-18-13-9-10(15)7-8-12(13)14-19(16,17)11-5-3-2-4-6-11/h2-9H,1H3/b14-12- |
| InChIKey | GLAUFNZPVFGIKR-OWBHPGMISA-N |
| XLogP | 1.49 |
| TPSA | 72.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.30 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|