C22H16N2O4S2 — CID 134925733
(NE)-N-[(1Z)-1-(benzenesulfonylimino)naphthalen-2-ylidene]benzenesulfonamide (PubChem CID 134925733) has the molecular formula C22H16N2O4S2 and a molecular weight of 436.51 g/mol. Its IUPAC name is (NE)-N-[(1Z)-1-(benzenesulfonylimino)naphthalen-2-ylidene]benzenesulfonamide.
| Compound Name | (NE)-N-[(1Z)-1-(benzenesulfonylimino)naphthalen-2-ylidene]benzenesulfonamide |
|---|---|
| PubChem CID | 134925733 |
| Molecular Formula | C22H16N2O4S2 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.06 |
| IUPAC Name | (NE)-N-[(1Z)-1-(benzenesulfonylimino)naphthalen-2-ylidene]benzenesulfonamide |
| SMILES | O=S(=O)(/N=C1C(=N\S(=O)(=O)c2ccccc2)\C=Cc2ccccc2\1)c1ccccc1 |
| InChI | InChI=1S/C22H16N2O4S2/c25-29(26,18-10-3-1-4-11-18)23-21-16-15-17-9-7-8-14-20(17)22(21)24-30(27,28)19-12-5-2-6-13-19/h1-16H/b23-21+,24-22- |
| InChIKey | MZIIDVBLRALJCK-CFPQKXLCSA-N |
| XLogP | 3.72 |
| TPSA | 93.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|