C25H21N2O5S2- — CID 2398561
[3-(benzenesulfonylimino)-4-oxonaphthalen-1-yl]-(4-propan-2-ylphenyl)sulfonylazanide (PubChem CID 2398561) has the molecular formula C25H21N2O5S2- and a molecular weight of 493.59 g/mol. Its IUPAC name is [3-(benzenesulfonylimino)-4-oxonaphthalen-1-yl]-(4-propan-2-ylphenyl)sulfonylazanide.
| Compound Name | [3-(benzenesulfonylimino)-4-oxonaphthalen-1-yl]-(4-propan-2-ylphenyl)sulfonylazanide |
|---|---|
| PubChem CID | 2398561 |
| Molecular Formula | C25H21N2O5S2- |
| Molecular Weight | 493.59 g/mol |
| Exact Mass | 493.09 |
| IUPAC Name | [3-(benzenesulfonylimino)-4-oxonaphthalen-1-yl]-(4-propan-2-ylphenyl)sulfonylazanide |
| SMILES | CC(C)c1ccc(S(=O)(=O)[N-]C2=CC(=NS(=O)(=O)c3ccccc3)C(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C25H21N2O5S2/c1-17(2)18-12-14-20(15-13-18)34(31,32)26-23-16-24(25(28)22-11-7-6-10-21(22)23)27-33(29,30)19-8-4-3-5-9-19/h3-17H,1-2H3/q-1 |
| InChIKey | ZZWGLJADUQTKGE-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 111.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.59 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|