C26H24N2O5S2 — CID 2398579
N-[3-(benzenesulfonamido)-4-oxonaphthalen-1-ylidene]-4-tert-butylbenzenesulfonamide (PubChem CID 2398579) has the molecular formula C26H24N2O5S2 and a molecular weight of 508.62 g/mol. Its IUPAC name is N-[3-(benzenesulfonamido)-4-oxonaphthalen-1-ylidene]-4-tert-butylbenzenesulfonamide.
| Compound Name | N-[3-(benzenesulfonamido)-4-oxonaphthalen-1-ylidene]-4-tert-butylbenzenesulfonamide |
|---|---|
| PubChem CID | 2398579 |
| Molecular Formula | C26H24N2O5S2 |
| Molecular Weight | 508.62 g/mol |
| Exact Mass | 508.11 |
| IUPAC Name | N-[3-(benzenesulfonamido)-4-oxonaphthalen-1-ylidene]-4-tert-butylbenzenesulfonamide |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)N=C2C=C(NS(=O)(=O)c3ccccc3)C(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C26H24N2O5S2/c1-26(2,3)18-13-15-20(16-14-18)35(32,33)27-23-17-24(25(29)22-12-8-7-11-21(22)23)28-34(30,31)19-9-5-4-6-10-19/h4-17,28H,1-3H3 |
| InChIKey | PHBQIHQMSMVNCI-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 109.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.62 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|